C19H23F3N4O3 — CID 143112132
1-butyl-N-ethyl-4-[[4-(trifluoromethoxy)phenyl]carbamoylamino]pyrrole-2-carboxamide (PubChem CID 143112132) has the molecular formula C19H23F3N4O3 and a molecular weight of 412.41 g/mol. Its IUPAC name is 1-butyl-N-ethyl-4-[[4-(trifluoromethoxy)phenyl]carbamoylamino]pyrrole-2-carboxamide.
| Compound Name | 1-butyl-N-ethyl-4-[[4-(trifluoromethoxy)phenyl]carbamoylamino]pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 143112132 |
| Molecular Formula | C19H23F3N4O3 |
| Molecular Weight | 412.41 g/mol |
| Exact Mass | 412.17 |
| IUPAC Name | 1-butyl-N-ethyl-4-[[4-(trifluoromethoxy)phenyl]carbamoylamino]pyrrole-2-carboxamide |
| SMILES | CCCCn1cc(NC(=O)Nc2ccc(OC(F)(F)F)cc2)cc1C(=O)NCC |
| InChI | InChI=1S/C19H23F3N4O3/c1-3-5-10-26-12-14(11-16(26)17(27)23-4-2)25-18(28)24-13-6-8-15(9-7-13)29-19(20,21)22/h6-9,11-12H,3-5,10H2,1-2H3,(H,23,27)(H2,24,25,28) |
| InChIKey | ZMQJQLRRWSUHPO-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 84.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.41 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |