C20H27F3N6O3 — CID 70857458
1-butyl-4-[(4-hydroxyphenyl)carbamoylamino]-N-[3-(2,2,2-trifluoroethylamino)propyl]imidazole-2-carboxamide (PubChem CID 70857458) has the molecular formula C20H27F3N6O3 and a molecular weight of 456.47 g/mol. Its IUPAC name is 1-butyl-4-[(4-hydroxyphenyl)carbamoylamino]-N-[3-(2,2,2-trifluoroethylamino)propyl]imidazole-2-carboxamide.
| Compound Name | 1-butyl-4-[(4-hydroxyphenyl)carbamoylamino]-N-[3-(2,2,2-trifluoroethylamino)propyl]imidazole-2-carboxamide |
|---|---|
| PubChem CID | 70857458 |
| Molecular Formula | C20H27F3N6O3 |
| Molecular Weight | 456.47 g/mol |
| Exact Mass | 456.21 |
| IUPAC Name | 1-butyl-4-[(4-hydroxyphenyl)carbamoylamino]-N-[3-(2,2,2-trifluoroethylamino)propyl]imidazole-2-carboxamide |
| SMILES | CCCCn1cc(NC(=O)Nc2ccc(O)cc2)nc1C(=O)NCCCNCC(F)(F)F |
| InChI | InChI=1S/C20H27F3N6O3/c1-2-3-11-29-12-16(28-19(32)26-14-5-7-15(30)8-6-14)27-17(29)18(31)25-10-4-9-24-13-20(21,22)23/h5-8,12,24,30H,2-4,9-11,13H2,1H3,(H,25,31)(H2,26,28,32) |
| InChIKey | BNAIVDOCDVWKBQ-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 120.31 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.47 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|