C17H14N2O+2 — CID 59429802
(11-oxoindeno[1,2-c]isoquinolin-6-ium-6-yl)methylazanium (PubChem CID 59429802) has the molecular formula C17H14N2O+2 and a molecular weight of 262.31 g/mol. Its IUPAC name is (11-oxoindeno[1,2-c]isoquinolin-6-ium-6-yl)methylazanium.
| Compound Name | (11-oxoindeno[1,2-c]isoquinolin-6-ium-6-yl)methylazanium |
|---|---|
| PubChem CID | 59429802 |
| Molecular Formula | C17H14N2O+2 |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.11 |
| IUPAC Name | (11-oxoindeno[1,2-c]isoquinolin-6-ium-6-yl)methylazanium |
| SMILES | [NH3+]C[n+]1cc2ccccc2c2c1-c1ccccc1C2=O |
| InChI | InChI=1S/C17H13N2O/c18-10-19-9-11-5-1-2-6-12(11)15-16(19)13-7-3-4-8-14(13)17(15)20/h1-9H,10,18H2/q+1/p+1 |
| InChIKey | WSZIJVWUGFKWEV-UHFFFAOYSA-O |
| XLogP | 1.54 |
| TPSA | 48.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'keto_phenone_A(11)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|