C17H14F3IrN3O-2 — CID 59431394
iridium;1-(3-methylbenzene-6-id-1-yl)pyrazole;1-[4-(trifluoromethyl)pyrrol-1-id-2-yl]ethanone (PubChem CID 59431394) has the molecular formula C17H14F3IrN3O-2 and a molecular weight of 525.53 g/mol. Its IUPAC name is iridium;1-(3-methylbenzene-6-id-1-yl)pyrazole;1-[4-(trifluoromethyl)pyrrol-1-id-2-yl]ethanone.
| Compound Name | iridium;1-(3-methylbenzene-6-id-1-yl)pyrazole;1-[4-(trifluoromethyl)pyrrol-1-id-2-yl]ethanone |
|---|---|
| PubChem CID | 59431394 |
| Molecular Formula | C17H14F3IrN3O-2 |
| Molecular Weight | 525.53 g/mol |
| Exact Mass | 526.07 |
| IUPAC Name | iridium;1-(3-methylbenzene-6-id-1-yl)pyrazole;1-[4-(trifluoromethyl)pyrrol-1-id-2-yl]ethanone |
| SMILES | CC(=O)c1cc(C(F)(F)F)c[n-]1.Cc1cc[c-]c(-n2cccn2)c1.[Ir] |
| InChI | InChI=1S/C10H9N2.C7H6F3NO.Ir/c1-9-4-2-5-10(8-9)12-7-3-6-11-12;1-4(12)6-2-5(3-11-6)7(8,9)10;/h2-4,6-8H,1H3;2-3H,1H3,(H,11,12);/q-1;;/p-1 |
| InChIKey | KMYMBTLCQWKSDH-UHFFFAOYSA-M |
| XLogP | 3.84 |
| TPSA | 48.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.53 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|