C32H35N2O3+ — CID 59435184
2-(7,7,9,17,19,19-hexamethyl-2-oxa-20-aza-6-azoniapentacyclo[12.8.0.03,12.05,10.016,21]docosa-1(14),3,5,10,12,15,21-heptaen-13-yl)benzoic acid (PubChem CID 59435184) has the molecular formula C32H35N2O3+ and a molecular weight of 495.64 g/mol. Its IUPAC name is 2-(7,7,9,17,19,19-hexamethyl-2-oxa-20-aza-6-azoniapentacyclo[12.8.0.03,12.05,10.016,21]docosa-1(14),3,5,10,12,15,21-heptaen-13-yl)benzoic acid.
| Compound Name | 2-(7,7,9,17,19,19-hexamethyl-2-oxa-20-aza-6-azoniapentacyclo[12.8.0.03,12.05,10.016,21]docosa-1(14),3,5,10,12,15,21-heptaen-13-yl)benzoic acid |
|---|---|
| PubChem CID | 59435184 |
| Molecular Formula | C32H35N2O3+ |
| Molecular Weight | 495.64 g/mol |
| Exact Mass | 495.26 |
| IUPAC Name | 2-(7,7,9,17,19,19-hexamethyl-2-oxa-20-aza-6-azoniapentacyclo[12.8.0.03,12.05,10.016,21]docosa-1(14),3,5,10,12,15,21-heptaen-13-yl)benzoic acid |
| SMILES | CC1CC(C)(C)Nc2cc3c(cc21)C(c1ccccc1C(=O)O)=c1cc2c(cc1O3)=[NH+]C(C)(C)CC2C |
| InChI | InChI=1S/C32H34N2O3/c1-17-15-31(3,4)33-25-13-27-23(11-21(17)25)29(19-9-7-8-10-20(19)30(35)36)24-12-22-18(2)16-32(5,6)34-26(22)14-28(24)37-27/h7-14,17-18,33H,15-16H2,1-6H3,(H,35,36)/p+1 |
| InChIKey | QFXTVPFONPVDMK-UHFFFAOYSA-O |
| XLogP | 4.42 |
| TPSA | 72.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.64 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |