C28H25F7N2O2 — CID 59438640
3-[(4R,7aS)-5-[2-[3,5-bis(trifluoromethyl)phenyl]acetyl]-4-(4-fluorophenyl)-3,3a,4,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridin-2-yl]cyclopent-2-en-1-one (PubChem CID 59438640) has the molecular formula C28H25F7N2O2 and a molecular weight of 554.51 g/mol. Its IUPAC name is 3-[(4R,7aS)-5-[2-[3,5-bis(trifluoromethyl)phenyl]acetyl]-4-(4-fluorophenyl)-3,3a,4,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridin-2-yl]cyclopent-2-en-1-one.
| Compound Name | 3-[(4R,7aS)-5-[2-[3,5-bis(trifluoromethyl)phenyl]acetyl]-4-(4-fluorophenyl)-3,3a,4,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridin-2-yl]cyclopent-2-en-1-one |
|---|---|
| PubChem CID | 59438640 |
| Molecular Formula | C28H25F7N2O2 |
| Molecular Weight | 554.51 g/mol |
| Exact Mass | 554.18 |
| IUPAC Name | 3-[(4R,7aS)-5-[2-[3,5-bis(trifluoromethyl)phenyl]acetyl]-4-(4-fluorophenyl)-3,3a,4,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridin-2-yl]cyclopent-2-en-1-one |
| SMILES | O=C1C=C(N2CC3[C@H](CCN(C(=O)Cc4cc(C(F)(F)F)cc(C(F)(F)F)c4)[C@H]3c3ccc(F)cc3)C2)CC1 |
| InChI | InChI=1S/C28H25F7N2O2/c29-21-3-1-17(2-4-21)26-24-15-36(22-5-6-23(38)13-22)14-18(24)7-8-37(26)25(39)11-16-9-19(27(30,31)32)12-20(10-16)28(33,34)35/h1-4,9-10,12-13,18,24,26H,5-8,11,14-15H2/t18-,24?,26+/m1/s1 |
| InChIKey | XOQQXISEZIMMMR-ZNSGIYGDSA-N |
| XLogP | 6.17 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.51 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |