C30H27F7N2O — CID 59438634
1-[(7aS)-2-benzyl-4-(4-fluorophenyl)-3,3a,4,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridin-5-yl]-2-[3,5-bis(trifluoromethyl)phenyl]ethanone (PubChem CID 59438634) has the molecular formula C30H27F7N2O and a molecular weight of 564.55 g/mol. Its IUPAC name is 1-[(7aS)-2-benzyl-4-(4-fluorophenyl)-3,3a,4,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridin-5-yl]-2-[3,5-bis(trifluoromethyl)phenyl]ethanone.
| Compound Name | 1-[(7aS)-2-benzyl-4-(4-fluorophenyl)-3,3a,4,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridin-5-yl]-2-[3,5-bis(trifluoromethyl)phenyl]ethanone |
|---|---|
| PubChem CID | 59438634 |
| Molecular Formula | C30H27F7N2O |
| Molecular Weight | 564.55 g/mol |
| Exact Mass | 564.20 |
| IUPAC Name | 1-[(7aS)-2-benzyl-4-(4-fluorophenyl)-3,3a,4,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridin-5-yl]-2-[3,5-bis(trifluoromethyl)phenyl]ethanone |
| SMILES | O=C(Cc1cc(C(F)(F)F)cc(C(F)(F)F)c1)N1CC[C@@H]2CN(Cc3ccccc3)CC2C1c1ccc(F)cc1 |
| InChI | InChI=1S/C30H27F7N2O/c31-25-8-6-21(7-9-25)28-26-18-38(16-19-4-2-1-3-5-19)17-22(26)10-11-39(28)27(40)14-20-12-23(29(32,33)34)15-24(13-20)30(35,36)37/h1-9,12-13,15,22,26,28H,10-11,14,16-18H2/t22-,26?,28?/m1/s1 |
| InChIKey | ZRZZHYGSNPYCKJ-MILJFOEMSA-N |
| XLogP | 7.13 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.55 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |