C25H42N4O4SSi — CID 59444781
diethyl-[(2S,3S)-2-[(2R,3S)-3-[(2S)-2-methyl-3-(1-phenyltetrazol-5-yl)sulfonylpropyl]oxiran-2-yl]pentan-3-yl]oxy-propan-2-ylsilane (PubChem CID 59444781) has the molecular formula C25H42N4O4SSi and a molecular weight of 522.79 g/mol. Its IUPAC name is diethyl-[(2S,3S)-2-[(2R,3S)-3-[(2S)-2-methyl-3-(1-phenyltetrazol-5-yl)sulfonylpropyl]oxiran-2-yl]pentan-3-yl]oxy-propan-2-ylsilane.
| Compound Name | diethyl-[(2S,3S)-2-[(2R,3S)-3-[(2S)-2-methyl-3-(1-phenyltetrazol-5-yl)sulfonylpropyl]oxiran-2-yl]pentan-3-yl]oxy-propan-2-ylsilane |
|---|---|
| PubChem CID | 59444781 |
| Molecular Formula | C25H42N4O4SSi |
| Molecular Weight | 522.79 g/mol |
| Exact Mass | 522.27 |
| IUPAC Name | diethyl-[(2S,3S)-2-[(2R,3S)-3-[(2S)-2-methyl-3-(1-phenyltetrazol-5-yl)sulfonylpropyl]oxiran-2-yl]pentan-3-yl]oxy-propan-2-ylsilane |
| SMILES | CC[C@H](O[Si](CC)(CC)C(C)C)[C@@H](C)[C@H]1O[C@H]1C[C@H](C)CS(=O)(=O)c1nnnn1-c1ccccc1 |
| InChI | InChI=1S/C25H42N4O4SSi/c1-8-22(33-35(9-2,10-3)18(4)5)20(7)24-23(32-24)16-19(6)17-34(30,31)25-26-27-28-29(25)21-14-12-11-13-15-21/h11-15,18-20,22-24H,8-10,16-17H2,1-7H3/t19-,20+,22-,23-,24+/m0/s1 |
| InChIKey | RUPGTPRZSJBHSF-RZYYESBJSA-N |
| XLogP | 5.06 |
| TPSA | 99.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.79 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|