About 3-[(4-bromophenyl)-(3,4-dichlorophenyl)methyl]azetidine
3-[(4-bromophenyl)-(3,4-dichlorophenyl)methyl]azetidine (PubChem CID 59446673) has the molecular formula C16H14BrCl2N
and a molecular weight of 371.11 g/mol. Its IUPAC name is 3-[(4-bromophenyl)-(3,4-dichlorophenyl)methyl]azetidine.
Molecular Properties
| Compound Name | 3-[(4-bromophenyl)-(3,4-dichlorophenyl)methyl]azetidine |
| PubChem CID | 59446673 |
| Molecular Formula | C16H14BrCl2N |
| Molecular Weight | 371.11 g/mol |
| Exact Mass | 368.97 |
| IUPAC Name | 3-[(4-bromophenyl)-(3,4-dichlorophenyl)methyl]azetidine |
| SMILES | Clc1ccc(C(c2ccc(Br)cc2)C2CNC2)cc1Cl |
| InChI | InChI=1S/C16H14BrCl2N/c17-13-4-1-10(2-5-13)16(12-8-20-9-12)11-3-6-14(18)15(19)7-11/h1-7,12,16,20H,8-9H2 |
| InChIKey | UULFGOFDSAHAJB-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 371.11 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-[(4-bromophenyl)-(3,4-dichlorophenyl)methyl]azetidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(4-bromophenyl)-(3,4-dichlorophenyl)methyl]azetidine?
The IUPAC name of 3-[(4-bromophenyl)-(3,4-dichlorophenyl)methyl]azetidine (CID 59446673) is 3-[(4-bromophenyl)-(3,4-dichlorophenyl)methyl]azetidine.
What is the SMILES notation for 3-[(4-bromophenyl)-(3,4-dichlorophenyl)methyl]azetidine?
The canonical SMILES for 3-[(4-bromophenyl)-(3,4-dichlorophenyl)methyl]azetidine is Clc1ccc(C(c2ccc(Br)cc2)C2CNC2)cc1Cl.
What is the InChIKey of 3-[(4-bromophenyl)-(3,4-dichlorophenyl)methyl]azetidine?
The InChIKey is UULFGOFDSAHAJB-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14BrCl2N/c17-13-4-1-10(2-5-13)16(12-8-20-9-12)11-3-6-14(18)15(19)7-11/h1-7,12,16,20H,8-9H2.
What are the key properties of 3-[(4-bromophenyl)-(3,4-dichlorophenyl)methyl]azetidine?
3-[(4-bromophenyl)-(3,4-dichlorophenyl)methyl]azetidine has a molecular weight of 371.11 g/mol, XLogP of 5.11, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(4-bromophenyl)-(3,4-dichlorophenyl)methyl]azetidine is sourced from PubChem (CID 59446673), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).