C34H35N3O3 — CID 59448707
[3-[(2-amino-2-benzylbutoxy)methyl]-5-(2-isocyanophenyl)phenyl]-[2-(furan-2-yl)pyrrolidin-1-yl]methanone (PubChem CID 59448707) has the molecular formula C34H35N3O3 and a molecular weight of 533.67 g/mol. Its IUPAC name is [3-[(2-amino-2-benzylbutoxy)methyl]-5-(2-isocyanophenyl)phenyl]-[2-(furan-2-yl)pyrrolidin-1-yl]methanone.
| Compound Name | [3-[(2-amino-2-benzylbutoxy)methyl]-5-(2-isocyanophenyl)phenyl]-[2-(furan-2-yl)pyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 59448707 |
| Molecular Formula | C34H35N3O3 |
| Molecular Weight | 533.67 g/mol |
| Exact Mass | 533.27 |
| IUPAC Name | [3-[(2-amino-2-benzylbutoxy)methyl]-5-(2-isocyanophenyl)phenyl]-[2-(furan-2-yl)pyrrolidin-1-yl]methanone |
| SMILES | [C-]#[N+]c1ccccc1-c1cc(COCC(N)(CC)Cc2ccccc2)cc(C(=O)N2CCCC2c2ccco2)c1 |
| InChI | InChI=1S/C34H35N3O3/c1-3-34(35,22-25-11-5-4-6-12-25)24-39-23-26-19-27(29-13-7-8-14-30(29)36-2)21-28(20-26)33(38)37-17-9-15-31(37)32-16-10-18-40-32/h4-8,10-14,16,18-21,31H,3,9,15,17,22-24,35H2,1H3 |
| InChIKey | FFJXGUKCFZMPHC-UHFFFAOYSA-N |
| XLogP | 7.34 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.67 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|