C25H24FN5O2 — CID 59453268
2-[2-[4-[[1-[(3-fluorophenyl)methyl]indol-5-yl]amino]pyrrolo[3,2-d]pyrimidin-5-yl]ethoxy]ethanol (PubChem CID 59453268) has the molecular formula C25H24FN5O2 and a molecular weight of 445.50 g/mol. Its IUPAC name is 2-[2-[4-[[1-[(3-fluorophenyl)methyl]indol-5-yl]amino]pyrrolo[3,2-d]pyrimidin-5-yl]ethoxy]ethanol.
| Compound Name | 2-[2-[4-[[1-[(3-fluorophenyl)methyl]indol-5-yl]amino]pyrrolo[3,2-d]pyrimidin-5-yl]ethoxy]ethanol |
|---|---|
| PubChem CID | 59453268 |
| Molecular Formula | C25H24FN5O2 |
| Molecular Weight | 445.50 g/mol |
| Exact Mass | 445.19 |
| IUPAC Name | 2-[2-[4-[[1-[(3-fluorophenyl)methyl]indol-5-yl]amino]pyrrolo[3,2-d]pyrimidin-5-yl]ethoxy]ethanol |
| SMILES | OCCOCCn1ccc2ncnc(Nc3ccc4c(ccn4Cc4cccc(F)c4)c3)c21 |
| InChI | InChI=1S/C25H24FN5O2/c26-20-3-1-2-18(14-20)16-31-8-6-19-15-21(4-5-23(19)31)29-25-24-22(27-17-28-25)7-9-30(24)10-12-33-13-11-32/h1-9,14-15,17,32H,10-13,16H2,(H,27,28,29) |
| InChIKey | CIZNCGKKHZRNIF-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 77.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.50 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|