About thiophen-3-ylmethyl 3-hydroxy-3-(thiophen-3-ylmethoxy)propanoate
thiophen-3-ylmethyl 3-hydroxy-3-(thiophen-3-ylmethoxy)propanoate (PubChem CID 59476020) has the molecular formula C13H14O4S2
and a molecular weight of 298.38 g/mol. Its IUPAC name is thiophen-3-ylmethyl 3-hydroxy-3-(thiophen-3-ylmethoxy)propanoate.
Molecular Properties
| Compound Name | thiophen-3-ylmethyl 3-hydroxy-3-(thiophen-3-ylmethoxy)propanoate |
| PubChem CID | 59476020 |
| Molecular Formula | C13H14O4S2 |
| Molecular Weight | 298.38 g/mol |
| Exact Mass | 298.03 |
| IUPAC Name | thiophen-3-ylmethyl 3-hydroxy-3-(thiophen-3-ylmethoxy)propanoate |
| SMILES | O=C(CC(O)OCc1ccsc1)OCc1ccsc1 |
| InChI | InChI=1S/C13H14O4S2/c14-12(16-6-10-1-3-18-8-10)5-13(15)17-7-11-2-4-19-9-11/h1-4,8-9,12,14H,5-7H2 |
| InChIKey | LMHAWGUFLUEOGP-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.38 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze thiophen-3-ylmethyl 3-hydroxy-3-(thiophen-3-ylmethoxy)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of thiophen-3-ylmethyl 3-hydroxy-3-(thiophen-3-ylmethoxy)propanoate?
The IUPAC name of thiophen-3-ylmethyl 3-hydroxy-3-(thiophen-3-ylmethoxy)propanoate (CID 59476020) is thiophen-3-ylmethyl 3-hydroxy-3-(thiophen-3-ylmethoxy)propanoate.
What is the SMILES notation for thiophen-3-ylmethyl 3-hydroxy-3-(thiophen-3-ylmethoxy)propanoate?
The canonical SMILES for thiophen-3-ylmethyl 3-hydroxy-3-(thiophen-3-ylmethoxy)propanoate is O=C(CC(O)OCc1ccsc1)OCc1ccsc1.
What is the InChIKey of thiophen-3-ylmethyl 3-hydroxy-3-(thiophen-3-ylmethoxy)propanoate?
The InChIKey is LMHAWGUFLUEOGP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14O4S2/c14-12(16-6-10-1-3-18-8-10)5-13(15)17-7-11-2-4-19-9-11/h1-4,8-9,12,14H,5-7H2.
What are the key properties of thiophen-3-ylmethyl 3-hydroxy-3-(thiophen-3-ylmethoxy)propanoate?
thiophen-3-ylmethyl 3-hydroxy-3-(thiophen-3-ylmethoxy)propanoate has a molecular weight of 298.38 g/mol, XLogP of 2.78, 7 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for thiophen-3-ylmethyl 3-hydroxy-3-(thiophen-3-ylmethoxy)propanoate is sourced from PubChem (CID 59476020), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).