C16H22F4O3S — CID 59480748
[3-fluoro-4-(4-methylcyclohexyl)-1-bicyclo[2.2.2]oct-2-enyl] trifluoromethanesulfonate (PubChem CID 59480748) has the molecular formula C16H22F4O3S and a molecular weight of 370.41 g/mol. Its IUPAC name is [3-fluoro-4-(4-methylcyclohexyl)-1-bicyclo[2.2.2]oct-2-enyl] trifluoromethanesulfonate.
| Compound Name | [3-fluoro-4-(4-methylcyclohexyl)-1-bicyclo[2.2.2]oct-2-enyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 59480748 |
| Molecular Formula | C16H22F4O3S |
| Molecular Weight | 370.41 g/mol |
| Exact Mass | 370.12 |
| IUPAC Name | [3-fluoro-4-(4-methylcyclohexyl)-1-bicyclo[2.2.2]oct-2-enyl] trifluoromethanesulfonate |
| SMILES | CC1CCC(C23CCC(OS(=O)(=O)C(F)(F)F)(C=C2F)CC3)CC1 |
| InChI | InChI=1S/C16H22F4O3S/c1-11-2-4-12(5-3-11)15-8-6-14(7-9-15,10-13(15)17)23-24(21,22)16(18,19)20/h10-12H,2-9H2,1H3 |
| InChIKey | KYZJHNTXWOLQEH-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.41 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|