C22H32F4O3S — CID 59481020
[3-fluoro-4-[4-(4-methylcyclohexyl)cyclohexyl]-1-bicyclo[2.2.2]oct-2-enyl] trifluoromethanesulfonate (PubChem CID 59481020) has the molecular formula C22H32F4O3S and a molecular weight of 452.55 g/mol. Its IUPAC name is [3-fluoro-4-[4-(4-methylcyclohexyl)cyclohexyl]-1-bicyclo[2.2.2]oct-2-enyl] trifluoromethanesulfonate.
| Compound Name | [3-fluoro-4-[4-(4-methylcyclohexyl)cyclohexyl]-1-bicyclo[2.2.2]oct-2-enyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 59481020 |
| Molecular Formula | C22H32F4O3S |
| Molecular Weight | 452.55 g/mol |
| Exact Mass | 452.20 |
| IUPAC Name | [3-fluoro-4-[4-(4-methylcyclohexyl)cyclohexyl]-1-bicyclo[2.2.2]oct-2-enyl] trifluoromethanesulfonate |
| SMILES | CC1CCC(C2CCC(C34CCC(OS(=O)(=O)C(F)(F)F)(C=C3F)CC4)CC2)CC1 |
| InChI | InChI=1S/C22H32F4O3S/c1-15-2-4-16(5-3-15)17-6-8-18(9-7-17)21-12-10-20(11-13-21,14-19(21)23)29-30(27,28)22(24,25)26/h14-18H,2-13H2,1H3 |
| InChIKey | RYQBXUMRVYFVEJ-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.55 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|