C18H24F4O3S — CID 59480826
[3-fluoro-4-(4-methyl-1-bicyclo[2.2.2]octanyl)-1-bicyclo[2.2.2]oct-2-enyl] trifluoromethanesulfonate (PubChem CID 59480826) has the molecular formula C18H24F4O3S and a molecular weight of 396.45 g/mol. Its IUPAC name is [3-fluoro-4-(4-methyl-1-bicyclo[2.2.2]octanyl)-1-bicyclo[2.2.2]oct-2-enyl] trifluoromethanesulfonate.
| Compound Name | [3-fluoro-4-(4-methyl-1-bicyclo[2.2.2]octanyl)-1-bicyclo[2.2.2]oct-2-enyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 59480826 |
| Molecular Formula | C18H24F4O3S |
| Molecular Weight | 396.45 g/mol |
| Exact Mass | 396.14 |
| IUPAC Name | [3-fluoro-4-(4-methyl-1-bicyclo[2.2.2]octanyl)-1-bicyclo[2.2.2]oct-2-enyl] trifluoromethanesulfonate |
| SMILES | CC12CCC(C34CCC(OS(=O)(=O)C(F)(F)F)(C=C3F)CC4)(CC1)CC2 |
| InChI | InChI=1S/C18H24F4O3S/c1-14-2-5-15(6-3-14,7-4-14)17-10-8-16(9-11-17,12-13(17)19)25-26(23,24)18(20,21)22/h12H,2-11H2,1H3 |
| InChIKey | JIZGZWCXWZRULF-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.45 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|