C16H19F7O3S — CID 59480733
[2,2,3,3-tetrafluoro-4-(4-methylcyclohex-3-en-1-yl)-1-bicyclo[2.2.2]octanyl] trifluoromethanesulfonate (PubChem CID 59480733) has the molecular formula C16H19F7O3S and a molecular weight of 424.38 g/mol. Its IUPAC name is [2,2,3,3-tetrafluoro-4-(4-methylcyclohex-3-en-1-yl)-1-bicyclo[2.2.2]octanyl] trifluoromethanesulfonate.
| Compound Name | [2,2,3,3-tetrafluoro-4-(4-methylcyclohex-3-en-1-yl)-1-bicyclo[2.2.2]octanyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 59480733 |
| Molecular Formula | C16H19F7O3S |
| Molecular Weight | 424.38 g/mol |
| Exact Mass | 424.09 |
| IUPAC Name | [2,2,3,3-tetrafluoro-4-(4-methylcyclohex-3-en-1-yl)-1-bicyclo[2.2.2]octanyl] trifluoromethanesulfonate |
| SMILES | CC1=CCC(C23CCC(OS(=O)(=O)C(F)(F)F)(CC2)C(F)(F)C3(F)F)CC1 |
| InChI | InChI=1S/C16H19F7O3S/c1-10-2-4-11(5-3-10)12-6-8-13(9-7-12,15(19,20)14(12,17)18)26-27(24,25)16(21,22)23/h2,11H,3-9H2,1H3 |
| InChIKey | JOUJEUPAMVCLCT-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.38 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|