C18H25F3O3S — CID 10785906
[(4aR,4bS,8aR,10aS)-2,4b,8-trimethyl-4,4a,5,6,8a,9,10,10a-octahydro-3H-phenanthren-1-yl] trifluoromethanesulfonate (PubChem CID 10785906) has the molecular formula C18H25F3O3S and a molecular weight of 378.46 g/mol. Its IUPAC name is [(4aR,4bS,8aR,10aS)-2,4b,8-trimethyl-4,4a,5,6,8a,9,10,10a-octahydro-3H-phenanthren-1-yl] trifluoromethanesulfonate.
| Compound Name | [(4aR,4bS,8aR,10aS)-2,4b,8-trimethyl-4,4a,5,6,8a,9,10,10a-octahydro-3H-phenanthren-1-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 10785906 |
| Molecular Formula | C18H25F3O3S |
| Molecular Weight | 378.46 g/mol |
| Exact Mass | 378.15 |
| IUPAC Name | [(4aR,4bS,8aR,10aS)-2,4b,8-trimethyl-4,4a,5,6,8a,9,10,10a-octahydro-3H-phenanthren-1-yl] trifluoromethanesulfonate |
| SMILES | CC1=CCC[C@]2(C)[C@@H]1CC[C@@H]1C(OS(=O)(=O)C(F)(F)F)=C(C)CC[C@H]12 |
| InChI | InChI=1S/C18H25F3O3S/c1-11-5-4-10-17(3)14(11)9-7-13-15(17)8-6-12(2)16(13)24-25(22,23)18(19,20)21/h5,13-15H,4,6-10H2,1-3H3/t13-,14+,15+,17+/m0/s1 |
| InChIKey | SUPBFIVNTNBACX-KLZNWCGWSA-N |
| XLogP | 5.31 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.46 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|