C14H13Cl2INO4PS — CID 59481775
methyl 3-[[(2,4-dichlorophenyl)-ethoxyphosphoryl]amino]-5-iodothiophene-2-carboxylate (PubChem CID 59481775) has the molecular formula C14H13Cl2INO4PS and a molecular weight of 520.11 g/mol. Its IUPAC name is methyl 3-[[(2,4-dichlorophenyl)-ethoxyphosphoryl]amino]-5-iodothiophene-2-carboxylate.
| Compound Name | methyl 3-[[(2,4-dichlorophenyl)-ethoxyphosphoryl]amino]-5-iodothiophene-2-carboxylate |
|---|---|
| PubChem CID | 59481775 |
| Molecular Formula | C14H13Cl2INO4PS |
| Molecular Weight | 520.11 g/mol |
| Exact Mass | 518.87 |
| IUPAC Name | methyl 3-[[(2,4-dichlorophenyl)-ethoxyphosphoryl]amino]-5-iodothiophene-2-carboxylate |
| SMILES | CCOP(=O)(Nc1cc(I)sc1C(=O)OC)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C14H13Cl2INO4PS/c1-3-22-23(20,11-5-4-8(15)6-9(11)16)18-10-7-12(17)24-13(10)14(19)21-2/h4-7H,3H2,1-2H3,(H,18,20) |
| InChIKey | NVPVTQSIAKSTNP-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.11 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|