C62H108N16O8 — CID 59482472
CID 59482472 (PubChem CID 59482472) has the molecular formula C62H108N16O8 and a molecular weight of 1205.65 g/mol.
| Compound Name | CID 59482472 |
|---|---|
| PubChem CID | 59482472 |
| Molecular Formula | C62H108N16O8 |
| Molecular Weight | 1205.65 g/mol |
| Exact Mass | 1204.85 |
| IUPAC Name | — |
| SMILES | CC1(C)CC(Nc2nc(OC3CC(C)(C)N([O])C(C)(C)C3)nc(N(CCN(c3nc(NC4CC(C)(C)N([O])C(C)(C)C4)nc(OC4CC(C)(C)N([O])C(C)(C)C4)n3)C3CC(C)(C)N([O])C(C)(C)C3)C3CC(C)(C)N([O])C(C)(C)C3)n2)CC(C)(C)N1[O] |
| InChI | InChI=1S/C62H108N16O8/c1-51(2)27-39(28-52(3,4)73(51)79)63-45-65-47(69-49(67-45)85-43-35-59(17,18)77(83)60(19,20)36-43)71(41-31-55(9,10)75(81)56(11,12)32-41)25-26-72(42-33-57(13,14)76(82)58(15,16)34-42)48-66-46(64-40-29-53(5,6)74(80)54(7,8)30-40)68-50(70-48)86-44-37-61(21,22)78(84)62(23,24)38-44/h39-44H,25-38H2,1-24H3,(H,63,65,67,69)(H,64,66,68,70) |
| InChIKey | IKWCHTFOHGIDPE-UHFFFAOYSA-N |
| XLogP | 10.15 |
| TPSA | 265.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 86 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1205.65 |
| LogP ≤ 5 | 10.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 18 |