C25H45N7O5 — CID 59482459
CID 59482459 (PubChem CID 59482459) has the molecular formula C25H45N7O5 and a molecular weight of 523.68 g/mol.
| Compound Name | CID 59482459 |
|---|---|
| PubChem CID | 59482459 |
| Molecular Formula | C25H45N7O5 |
| Molecular Weight | 523.68 g/mol |
| Exact Mass | 523.35 |
| IUPAC Name | — |
| SMILES | CC1(C)CC(Nc2nc(OC3CC(C)(C)N([O])C(C)(C)C3)nc(N(CCO)CCO)n2)CC(C)(C)N1[O] |
| InChI | InChI=1S/C25H45N7O5/c1-22(2)13-17(14-23(3,4)31(22)35)26-19-27-20(30(9-11-33)10-12-34)29-21(28-19)37-18-15-24(5,6)32(36)25(7,8)16-18/h17-18,33-34H,9-16H2,1-8H3,(H,26,27,28,29) |
| InChIKey | DIITXFQWEGYUAN-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 149.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.68 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |