C22H41N9O2 — CID 59482524
CID 59482524 (PubChem CID 59482524) has the molecular formula C22H41N9O2 and a molecular weight of 463.63 g/mol.
| Compound Name | CID 59482524 |
|---|---|
| PubChem CID | 59482524 |
| Molecular Formula | C22H41N9O2 |
| Molecular Weight | 463.63 g/mol |
| Exact Mass | 463.34 |
| IUPAC Name | — |
| SMILES | CNNc1nc(NC2CC(C)(C)N([O])C(C)(C)C2)nc(NC2CC(C)(C)N([O])C(C)(C)C2)n1 |
| InChI | InChI=1S/C22H41N9O2/c1-19(2)10-14(11-20(3,4)30(19)32)24-16-26-17(28-18(27-16)29-23-9)25-15-12-21(5,6)31(33)22(7,8)13-15/h14-15,23H,10-13H2,1-9H3,(H3,24,25,26,27,28,29) |
| InChIKey | UANQGWVFKSLQAJ-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 133.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.63 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|