About CID 71764178
CID 71764178 (PubChem CID 71764178) has the molecular formula C17H33N3O2
and a molecular weight of 311.47 g/mol.
Molecular Properties
| Compound Name | CID 71764178 |
| PubChem CID | 71764178 |
| Molecular Formula | C17H33N3O2 |
| Molecular Weight | 311.47 g/mol |
| Exact Mass | 311.26 |
| IUPAC Name | — |
| SMILES | CC1(C)CC(NC2CC(C)(C)N([O])C2(C)C)CC(C)(C)N1[O] |
| InChI | InChI=1S/C17H33N3O2/c1-14(2)9-12(10-15(3,4)19(14)21)18-13-11-16(5,6)20(22)17(13,7)8/h12-13,18H,9-11H2,1-8H3 |
| InChIKey | CVSGRXVXFULMSB-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 58.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.47 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze CID 71764178 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 71764178?
The IUPAC name of CID 71764178 (CID 71764178) is not available.
What is the SMILES notation for CID 71764178?
The canonical SMILES for CID 71764178 is CC1(C)CC(NC2CC(C)(C)N([O])C2(C)C)CC(C)(C)N1[O].
What is the InChIKey of CID 71764178?
The InChIKey is CVSGRXVXFULMSB-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H33N3O2/c1-14(2)9-12(10-15(3,4)19(14)21)18-13-11-16(5,6)20(22)17(13,7)8/h12-13,18H,9-11H2,1-8H3.
What are the key properties of CID 71764178?
CID 71764178 has a molecular weight of 311.47 g/mol, XLogP of 2.92, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 71764178 is sourced from PubChem (CID 71764178), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).