C23H41N7O4 — CID 59482500
CID 59482500 (PubChem CID 59482500) has the molecular formula C23H41N7O4 and a molecular weight of 479.63 g/mol.
| Compound Name | CID 59482500 |
|---|---|
| PubChem CID | 59482500 |
| Molecular Formula | C23H41N7O4 |
| Molecular Weight | 479.63 g/mol |
| Exact Mass | 479.32 |
| IUPAC Name | — |
| SMILES | CC1(C)CC(Nc2nc(NCCO)nc(OC3CC(C)(C)N([O])C(C)(C)C3)n2)CC(C)(C)N1[O] |
| InChI | InChI=1S/C23H41N7O4/c1-20(2)11-15(12-21(3,4)29(20)32)25-18-26-17(24-9-10-31)27-19(28-18)34-16-13-22(5,6)30(33)23(7,8)14-16/h15-16,31H,9-14H2,1-8H3,(H2,24,25,26,27,28) |
| InChIKey | RVVPYUNQZKZXKW-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 138.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.63 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |