C25H28FN5O5 — CID 59495496
4-[[1-(5-ethoxy-2-fluoro-4-propan-2-yloxyphenyl)-2-[2-(furan-2-carbonyl)hydrazinyl]-2-oxoethyl]amino]benzenecarboximidamide (PubChem CID 59495496) has the molecular formula C25H28FN5O5 and a molecular weight of 497.53 g/mol. Its IUPAC name is 4-[[1-(5-ethoxy-2-fluoro-4-propan-2-yloxyphenyl)-2-[2-(furan-2-carbonyl)hydrazinyl]-2-oxoethyl]amino]benzenecarboximidamide.
| Compound Name | 4-[[1-(5-ethoxy-2-fluoro-4-propan-2-yloxyphenyl)-2-[2-(furan-2-carbonyl)hydrazinyl]-2-oxoethyl]amino]benzenecarboximidamide |
|---|---|
| PubChem CID | 59495496 |
| Molecular Formula | C25H28FN5O5 |
| Molecular Weight | 497.53 g/mol |
| Exact Mass | 497.21 |
| IUPAC Name | 4-[[1-(5-ethoxy-2-fluoro-4-propan-2-yloxyphenyl)-2-[2-(furan-2-carbonyl)hydrazinyl]-2-oxoethyl]amino]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(NC(C(=O)NNC(=O)c2ccco2)c2cc(OCC)c(OC(C)C)cc2F)cc1 |
| InChI | InChI=1S/C25H28FN5O5/c1-4-34-20-12-17(18(26)13-21(20)36-14(2)3)22(29-16-9-7-15(8-10-16)23(27)28)25(33)31-30-24(32)19-6-5-11-35-19/h5-14,22,29H,4H2,1-3H3,(H3,27,28)(H,30,32)(H,31,33) |
| InChIKey | GQXPAXJZSBKGJH-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 151.70 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.53 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|