C12H20O5 — CID 59499840
[2-hydroxy-2-(3-methyl-2-oxobut-3-enoxy)ethyl] 2-methylbutanoate (PubChem CID 59499840) has the molecular formula C12H20O5 and a molecular weight of 244.29 g/mol. Its IUPAC name is [2-hydroxy-2-(3-methyl-2-oxobut-3-enoxy)ethyl] 2-methylbutanoate.
| Compound Name | [2-hydroxy-2-(3-methyl-2-oxobut-3-enoxy)ethyl] 2-methylbutanoate |
|---|---|
| PubChem CID | 59499840 |
| Molecular Formula | C12H20O5 |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.13 |
| IUPAC Name | [2-hydroxy-2-(3-methyl-2-oxobut-3-enoxy)ethyl] 2-methylbutanoate |
| SMILES | C=C(C)C(=O)COC(O)COC(=O)C(C)CC |
| InChI | InChI=1S/C12H20O5/c1-5-9(4)12(15)17-7-11(14)16-6-10(13)8(2)3/h9,11,14H,2,5-7H2,1,3-4H3 |
| InChIKey | BBXAYYZADBDYJM-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|