C26H26FN3O2 — CID 59502170
(3S,3aS,7E)-3-(4-fluorophenyl)-7-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]-3-methyl-3a,4,5,6-tetrahydro-2,1-benzoxazole (PubChem CID 59502170) has the molecular formula C26H26FN3O2 and a molecular weight of 431.51 g/mol. Its IUPAC name is (3S,3aS,7E)-3-(4-fluorophenyl)-7-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]-3-methyl-3a,4,5,6-tetrahydro-2,1-benzoxazole.
| Compound Name | (3S,3aS,7E)-3-(4-fluorophenyl)-7-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]-3-methyl-3a,4,5,6-tetrahydro-2,1-benzoxazole |
|---|---|
| PubChem CID | 59502170 |
| Molecular Formula | C26H26FN3O2 |
| Molecular Weight | 431.51 g/mol |
| Exact Mass | 431.20 |
| IUPAC Name | (3S,3aS,7E)-3-(4-fluorophenyl)-7-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]-3-methyl-3a,4,5,6-tetrahydro-2,1-benzoxazole |
| SMILES | COc1cc(/C=C2\CCC[C@H]3C2=NO[C@]3(C)c2ccc(F)cc2)ccc1-n1cnc(C)c1 |
| InChI | InChI=1S/C26H26FN3O2/c1-17-15-30(16-28-17)23-12-7-18(14-24(23)31-3)13-19-5-4-6-22-25(19)29-32-26(22,2)20-8-10-21(27)11-9-20/h7-16,22H,4-6H2,1-3H3/b19-13+/t22-,26+/m0/s1 |
| InChIKey | IKMUGHRVJOVMII-MLGBUKCBSA-N |
| XLogP | 5.81 |
| TPSA | 48.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.51 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |