C20H28N2O2 — CID 59510746
3-(4-tert-butyl-4,5-dihydro-1,3-oxazol-2-yl)-N-cyclohexylbenzamide (PubChem CID 59510746) has the molecular formula C20H28N2O2 and a molecular weight of 328.46 g/mol. Its IUPAC name is 3-(4-tert-butyl-4,5-dihydro-1,3-oxazol-2-yl)-N-cyclohexylbenzamide.
| Compound Name | 3-(4-tert-butyl-4,5-dihydro-1,3-oxazol-2-yl)-N-cyclohexylbenzamide |
|---|---|
| PubChem CID | 59510746 |
| Molecular Formula | C20H28N2O2 |
| Molecular Weight | 328.46 g/mol |
| Exact Mass | 328.22 |
| IUPAC Name | 3-(4-tert-butyl-4,5-dihydro-1,3-oxazol-2-yl)-N-cyclohexylbenzamide |
| SMILES | CC(C)(C)C1COC(c2cccc(C(=O)NC3CCCCC3)c2)=N1 |
| InChI | InChI=1S/C20H28N2O2/c1-20(2,3)17-13-24-19(22-17)15-9-7-8-14(12-15)18(23)21-16-10-5-4-6-11-16/h7-9,12,16-17H,4-6,10-11,13H2,1-3H3,(H,21,23) |
| InChIKey | HEKVRNHFWONRFA-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.46 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |