C21H19ClN2O5S — CID 59514725
3-chloro-N-[(3S,4R)-3-hydroxy-6-isocyano-1',1'-dioxospiro[3,4-dihydrochromene-2,4'-thiane]-4-yl]benzamide (PubChem CID 59514725) has the molecular formula C21H19ClN2O5S and a molecular weight of 446.91 g/mol. Its IUPAC name is 3-chloro-N-[(3S,4R)-3-hydroxy-6-isocyano-1',1'-dioxospiro[3,4-dihydrochromene-2,4'-thiane]-4-yl]benzamide.
| Compound Name | 3-chloro-N-[(3S,4R)-3-hydroxy-6-isocyano-1',1'-dioxospiro[3,4-dihydrochromene-2,4'-thiane]-4-yl]benzamide |
|---|---|
| PubChem CID | 59514725 |
| Molecular Formula | C21H19ClN2O5S |
| Molecular Weight | 446.91 g/mol |
| Exact Mass | 446.07 |
| IUPAC Name | 3-chloro-N-[(3S,4R)-3-hydroxy-6-isocyano-1',1'-dioxospiro[3,4-dihydrochromene-2,4'-thiane]-4-yl]benzamide |
| SMILES | [C-]#[N+]c1ccc2c(c1)[C@@H](NC(=O)c1cccc(Cl)c1)[C@H](O)C1(CCS(=O)(=O)CC1)O2 |
| InChI | InChI=1S/C21H19ClN2O5S/c1-23-15-5-6-17-16(12-15)18(24-20(26)13-3-2-4-14(22)11-13)19(25)21(29-17)7-9-30(27,28)10-8-21/h2-6,11-12,18-19,25H,7-10H2,(H,24,26)/t18-,19+/m1/s1 |
| InChIKey | BUDWFSIBHSZDKX-MOPGFXCFSA-N |
| XLogP | 3.06 |
| TPSA | 97.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.91 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|