C12H12ClNO4 — CID 71440129
3-chloro-N-[4-(hydroxymethyl)-2-oxooxolan-3-yl]benzamide (PubChem CID 71440129) has the molecular formula C12H12ClNO4 and a molecular weight of 269.68 g/mol. Its IUPAC name is 3-chloro-N-[4-(hydroxymethyl)-2-oxooxolan-3-yl]benzamide.
| Compound Name | 3-chloro-N-[4-(hydroxymethyl)-2-oxooxolan-3-yl]benzamide |
|---|---|
| PubChem CID | 71440129 |
| Molecular Formula | C12H12ClNO4 |
| Molecular Weight | 269.68 g/mol |
| Exact Mass | 269.05 |
| IUPAC Name | 3-chloro-N-[4-(hydroxymethyl)-2-oxooxolan-3-yl]benzamide |
| SMILES | O=C(NC1C(=O)OCC1CO)c1cccc(Cl)c1 |
| InChI | InChI=1S/C12H12ClNO4/c13-9-3-1-2-7(4-9)11(16)14-10-8(5-15)6-18-12(10)17/h1-4,8,10,15H,5-6H2,(H,14,16) |
| InChIKey | RKEXWKZAMJKTHT-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.68 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |