C20H17IrNO2S- — CID 59517860
CID 59517860 (PubChem CID 59517860) has the molecular formula C20H17IrNO2S- and a molecular weight of 527.65 g/mol.
| Compound Name | CID 59517860 |
|---|---|
| PubChem CID | 59517860 |
| Molecular Formula | C20H17IrNO2S- |
| Molecular Weight | 527.65 g/mol |
| Exact Mass | 528.06 |
| IUPAC Name | — |
| SMILES | CC(=O)/C=C(\O)C[CH]Cc1cccc(-c2[c-]c3ccccc3s2)n1.[Ir] |
| InChI | InChI=1S/C20H17NO2S.Ir/c1-14(22)12-17(23)9-4-7-16-8-5-10-18(21-16)20-13-15-6-2-3-11-19(15)24-20;/h2-6,8,10-12,23H,7,9H2,1H3;/q-1;/b17-12-; |
| InChIKey | UDMRXRGSPRGNPX-HBPAQXCTSA-N |
| XLogP | 4.93 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.65 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|