C11H30O3Si3 — CID 59524489
3-[methyl-(trimethylsilylmethoxy)-trimethylsilyloxysilyl]propan-1-ol (PubChem CID 59524489) has the molecular formula C11H30O3Si3 and a molecular weight of 294.62 g/mol. Its IUPAC name is 3-[methyl-(trimethylsilylmethoxy)-trimethylsilyloxysilyl]propan-1-ol.
| Compound Name | 3-[methyl-(trimethylsilylmethoxy)-trimethylsilyloxysilyl]propan-1-ol |
|---|---|
| PubChem CID | 59524489 |
| Molecular Formula | C11H30O3Si3 |
| Molecular Weight | 294.62 g/mol |
| Exact Mass | 294.15 |
| IUPAC Name | 3-[methyl-(trimethylsilylmethoxy)-trimethylsilyloxysilyl]propan-1-ol |
| SMILES | C[Si](C)(C)CO[Si](C)(CCCO)O[Si](C)(C)C |
| InChI | InChI=1S/C11H30O3Si3/c1-15(2,3)11-13-17(7,10-8-9-12)14-16(4,5)6/h12H,8-11H2,1-7H3 |
| InChIKey | GBFIPGAGTKCXEF-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.62 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|