C23H24F4N2O5 — CID 59530973
benzyl N-[(1R,2R)-1-hydroxy-3-pyrrolidin-1-yl-1-(2,2,3,3-tetrafluoro-1,4-benzodioxin-6-yl)propan-2-yl]carbamate (PubChem CID 59530973) has the molecular formula C23H24F4N2O5 and a molecular weight of 484.45 g/mol. Its IUPAC name is benzyl N-[(1R,2R)-1-hydroxy-3-pyrrolidin-1-yl-1-(2,2,3,3-tetrafluoro-1,4-benzodioxin-6-yl)propan-2-yl]carbamate.
| Compound Name | benzyl N-[(1R,2R)-1-hydroxy-3-pyrrolidin-1-yl-1-(2,2,3,3-tetrafluoro-1,4-benzodioxin-6-yl)propan-2-yl]carbamate |
|---|---|
| PubChem CID | 59530973 |
| Molecular Formula | C23H24F4N2O5 |
| Molecular Weight | 484.45 g/mol |
| Exact Mass | 484.16 |
| IUPAC Name | benzyl N-[(1R,2R)-1-hydroxy-3-pyrrolidin-1-yl-1-(2,2,3,3-tetrafluoro-1,4-benzodioxin-6-yl)propan-2-yl]carbamate |
| SMILES | O=C(N[C@H](CN1CCCC1)[C@H](O)c1ccc2c(c1)OC(F)(F)C(F)(F)O2)OCc1ccccc1 |
| InChI | InChI=1S/C23H24F4N2O5/c24-22(25)23(26,27)34-19-12-16(8-9-18(19)33-22)20(30)17(13-29-10-4-5-11-29)28-21(31)32-14-15-6-2-1-3-7-15/h1-3,6-9,12,17,20,30H,4-5,10-11,13-14H2,(H,28,31)/t17-,20-/m1/s1 |
| InChIKey | OFFCDIZTGQNFIW-YLJYHZDGSA-N |
| XLogP | 4.07 |
| TPSA | 80.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.45 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|