C18H29N3O — CID 59536622
N-cyclopropyl-6-methyl-5-[3-methyl-1-[(3S)-pyrrolidin-3-yl]butoxy]pyridin-2-amine (PubChem CID 59536622) has the molecular formula C18H29N3O and a molecular weight of 303.45 g/mol. Its IUPAC name is N-cyclopropyl-6-methyl-5-[3-methyl-1-[(3S)-pyrrolidin-3-yl]butoxy]pyridin-2-amine.
| Compound Name | N-cyclopropyl-6-methyl-5-[3-methyl-1-[(3S)-pyrrolidin-3-yl]butoxy]pyridin-2-amine |
|---|---|
| PubChem CID | 59536622 |
| Molecular Formula | C18H29N3O |
| Molecular Weight | 303.45 g/mol |
| Exact Mass | 303.23 |
| IUPAC Name | N-cyclopropyl-6-methyl-5-[3-methyl-1-[(3S)-pyrrolidin-3-yl]butoxy]pyridin-2-amine |
| SMILES | Cc1nc(NC2CC2)ccc1OC(CC(C)C)[C@H]1CCNC1 |
| InChI | InChI=1S/C18H29N3O/c1-12(2)10-17(14-8-9-19-11-14)22-16-6-7-18(20-13(16)3)21-15-4-5-15/h6-7,12,14-15,17,19H,4-5,8-11H2,1-3H3,(H,20,21)/t14-,17?/m0/s1 |
| InChIKey | AVJRTZVLKRZLKW-MBIQTGHCSA-N |
| XLogP | 3.37 |
| TPSA | 46.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.45 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |