C27H31N3O6 — CID 59544676
[(1S)-1-(3,4,5-trimethoxyphenyl)ethyl] N-[(1S)-1-[4-[(2-aminophenyl)carbamoyl]phenyl]ethyl]carbamate (PubChem CID 59544676) has the molecular formula C27H31N3O6 and a molecular weight of 493.56 g/mol. Its IUPAC name is [(1S)-1-(3,4,5-trimethoxyphenyl)ethyl] N-[(1S)-1-[4-[(2-aminophenyl)carbamoyl]phenyl]ethyl]carbamate.
| Compound Name | [(1S)-1-(3,4,5-trimethoxyphenyl)ethyl] N-[(1S)-1-[4-[(2-aminophenyl)carbamoyl]phenyl]ethyl]carbamate |
|---|---|
| PubChem CID | 59544676 |
| Molecular Formula | C27H31N3O6 |
| Molecular Weight | 493.56 g/mol |
| Exact Mass | 493.22 |
| IUPAC Name | [(1S)-1-(3,4,5-trimethoxyphenyl)ethyl] N-[(1S)-1-[4-[(2-aminophenyl)carbamoyl]phenyl]ethyl]carbamate |
| SMILES | COc1cc([C@H](C)OC(=O)N[C@@H](C)c2ccc(C(=O)Nc3ccccc3N)cc2)cc(OC)c1OC |
| InChI | InChI=1S/C27H31N3O6/c1-16(18-10-12-19(13-11-18)26(31)30-22-9-7-6-8-21(22)28)29-27(32)36-17(2)20-14-23(33-3)25(35-5)24(15-20)34-4/h6-17H,28H2,1-5H3,(H,29,32)(H,30,31)/t16-,17-/m0/s1 |
| InChIKey | SFCXIXGHZDSXMK-IRXDYDNUSA-N |
| XLogP | 5.10 |
| TPSA | 121.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.56 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|