C23H21F5NO2Pt- — CID 59546863
2-(2,4-difluorobenzene-6-id-1-yl)pyridine;platinum;3-[3-(trifluoromethyl)phenyl]pentane-2,4-diol (PubChem CID 59546863) has the molecular formula C23H21F5NO2Pt- and a molecular weight of 633.49 g/mol. Its IUPAC name is 2-(2,4-difluorobenzene-6-id-1-yl)pyridine;platinum;3-[3-(trifluoromethyl)phenyl]pentane-2,4-diol.
| Compound Name | 2-(2,4-difluorobenzene-6-id-1-yl)pyridine;platinum;3-[3-(trifluoromethyl)phenyl]pentane-2,4-diol |
|---|---|
| PubChem CID | 59546863 |
| Molecular Formula | C23H21F5NO2Pt- |
| Molecular Weight | 633.49 g/mol |
| Exact Mass | 633.11 |
| IUPAC Name | 2-(2,4-difluorobenzene-6-id-1-yl)pyridine;platinum;3-[3-(trifluoromethyl)phenyl]pentane-2,4-diol |
| SMILES | CC(O)C(c1cccc(C(F)(F)F)c1)C(C)O.Fc1c[c-]c(-c2ccccn2)c(F)c1.[Pt] |
| InChI | InChI=1S/C12H15F3O2.C11H6F2N.Pt/c1-7(16)11(8(2)17)9-4-3-5-10(6-9)12(13,14)15;12-8-4-5-9(10(13)7-8)11-3-1-2-6-14-11;/h3-8,11,16-17H,1-2H3;1-4,6-7H;/q;-1; |
| InChIKey | UQTQWNVPJVRCMY-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 53.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.49 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|