C16H23FN4O2S2 — CID 59549747
N-[5-[[5-(4-fluorophenyl)-1,3,4-thiadiazol-2-yl]amino]pentyl]propane-2-sulfonamide (PubChem CID 59549747) has the molecular formula C16H23FN4O2S2 and a molecular weight of 386.52 g/mol. Its IUPAC name is N-[5-[[5-(4-fluorophenyl)-1,3,4-thiadiazol-2-yl]amino]pentyl]propane-2-sulfonamide.
| Compound Name | N-[5-[[5-(4-fluorophenyl)-1,3,4-thiadiazol-2-yl]amino]pentyl]propane-2-sulfonamide |
|---|---|
| PubChem CID | 59549747 |
| Molecular Formula | C16H23FN4O2S2 |
| Molecular Weight | 386.52 g/mol |
| Exact Mass | 386.12 |
| IUPAC Name | N-[5-[[5-(4-fluorophenyl)-1,3,4-thiadiazol-2-yl]amino]pentyl]propane-2-sulfonamide |
| SMILES | CC(C)S(=O)(=O)NCCCCCNc1nnc(-c2ccc(F)cc2)s1 |
| InChI | InChI=1S/C16H23FN4O2S2/c1-12(2)25(22,23)19-11-5-3-4-10-18-16-21-20-15(24-16)13-6-8-14(17)9-7-13/h6-9,12,19H,3-5,10-11H2,1-2H3,(H,18,21) |
| InChIKey | GDKZQDVRVNMJPJ-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.52 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|