C16H26N4O2S2 — CID 90944908
N-[5-[4-(4,5-dihydrothiadiazol-4-yl)anilino]pentyl]propane-2-sulfonamide (PubChem CID 90944908) has the molecular formula C16H26N4O2S2 and a molecular weight of 370.54 g/mol. Its IUPAC name is N-[5-[4-(4,5-dihydrothiadiazol-4-yl)anilino]pentyl]propane-2-sulfonamide.
| Compound Name | N-[5-[4-(4,5-dihydrothiadiazol-4-yl)anilino]pentyl]propane-2-sulfonamide |
|---|---|
| PubChem CID | 90944908 |
| Molecular Formula | C16H26N4O2S2 |
| Molecular Weight | 370.54 g/mol |
| Exact Mass | 370.15 |
| IUPAC Name | N-[5-[4-(4,5-dihydrothiadiazol-4-yl)anilino]pentyl]propane-2-sulfonamide |
| SMILES | CC(C)S(=O)(=O)NCCCCCNc1ccc(C2CSN=N2)cc1 |
| InChI | InChI=1S/C16H26N4O2S2/c1-13(2)24(21,22)18-11-5-3-4-10-17-15-8-6-14(7-9-15)16-12-23-20-19-16/h6-9,13,16-18H,3-5,10-12H2,1-2H3 |
| InChIKey | LHPYPLRXOPNNBH-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 82.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.54 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|