C20H22CuN3O+ — CID 59551633
copper;2-[[bis(pyridin-2-ylmethyl)amino]methyl]phenol;carbanide (PubChem CID 59551633) has the molecular formula C20H22CuN3O+ and a molecular weight of 383.96 g/mol. Its IUPAC name is copper;2-[[bis(pyridin-2-ylmethyl)amino]methyl]phenol;carbanide.
| Compound Name | copper;2-[[bis(pyridin-2-ylmethyl)amino]methyl]phenol;carbanide |
|---|---|
| PubChem CID | 59551633 |
| Molecular Formula | C20H22CuN3O+ |
| Molecular Weight | 383.96 g/mol |
| Exact Mass | 383.11 |
| IUPAC Name | copper;2-[[bis(pyridin-2-ylmethyl)amino]methyl]phenol;carbanide |
| SMILES | Oc1ccccc1CN(Cc1ccccn1)Cc1ccccn1.[CH3-].[Cu+2] |
| InChI | InChI=1S/C19H19N3O.CH3.Cu/c23-19-10-2-1-7-16(19)13-22(14-17-8-3-5-11-20-17)15-18-9-4-6-12-21-18;;/h1-12,23H,13-15H2;1H3;/q;-1;+2 |
| InChIKey | UNKGYJASCLGDKN-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 49.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.96 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|