C19H19NO5S — CID 59563373
1-[[dihydroxy-[4-(4-methylphenoxy)phenyl]-λ4-sulfanyl]methyl]-3-hydroxypyridin-2-one (PubChem CID 59563373) has the molecular formula C19H19NO5S and a molecular weight of 373.43 g/mol. Its IUPAC name is 1-[[dihydroxy-[4-(4-methylphenoxy)phenyl]-λ4-sulfanyl]methyl]-3-hydroxypyridin-2-one.
| Compound Name | 1-[[dihydroxy-[4-(4-methylphenoxy)phenyl]-λ4-sulfanyl]methyl]-3-hydroxypyridin-2-one |
|---|---|
| PubChem CID | 59563373 |
| Molecular Formula | C19H19NO5S |
| Molecular Weight | 373.43 g/mol |
| Exact Mass | 373.10 |
| IUPAC Name | 1-[[dihydroxy-[4-(4-methylphenoxy)phenyl]-λ4-sulfanyl]methyl]-3-hydroxypyridin-2-one |
| SMILES | Cc1ccc(Oc2ccc(S(O)(O)Cn3cccc(O)c3=O)cc2)cc1 |
| InChI | InChI=1S/C19H19NO5S/c1-14-4-6-15(7-5-14)25-16-8-10-17(11-9-16)26(23,24)13-20-12-2-3-18(21)19(20)22/h2-12,21,23-24H,13H2,1H3 |
| InChIKey | KMRZUVUOJVRFMV-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 91.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.43 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |