C20H19NO4 — CID 59575811
benzyl 1-benzyl-3-hydroxy-6-oxo-2,5-dihydropyridine-4-carboxylate (PubChem CID 59575811) has the molecular formula C20H19NO4 and a molecular weight of 337.38 g/mol. Its IUPAC name is benzyl 1-benzyl-3-hydroxy-6-oxo-2,5-dihydropyridine-4-carboxylate.
| Compound Name | benzyl 1-benzyl-3-hydroxy-6-oxo-2,5-dihydropyridine-4-carboxylate |
|---|---|
| PubChem CID | 59575811 |
| Molecular Formula | C20H19NO4 |
| Molecular Weight | 337.38 g/mol |
| Exact Mass | 337.13 |
| IUPAC Name | benzyl 1-benzyl-3-hydroxy-6-oxo-2,5-dihydropyridine-4-carboxylate |
| SMILES | O=C(OCc1ccccc1)C1=C(O)CN(Cc2ccccc2)C(=O)C1 |
| InChI | InChI=1S/C20H19NO4/c22-18-13-21(12-15-7-3-1-4-8-15)19(23)11-17(18)20(24)25-14-16-9-5-2-6-10-16/h1-10,22H,11-14H2 |
| InChIKey | ZPLBIDRVDMCSNE-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.38 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |