C13H28N2O — CID 59576148
1-ethyl-3-(4,4,5,5-tetramethylhexyl)urea (PubChem CID 59576148) has the molecular formula C13H28N2O and a molecular weight of 228.38 g/mol. Its IUPAC name is 1-ethyl-3-(4,4,5,5-tetramethylhexyl)urea.
| Compound Name | 1-ethyl-3-(4,4,5,5-tetramethylhexyl)urea |
|---|---|
| PubChem CID | 59576148 |
| Molecular Formula | C13H28N2O |
| Molecular Weight | 228.38 g/mol |
| Exact Mass | 228.22 |
| IUPAC Name | 1-ethyl-3-(4,4,5,5-tetramethylhexyl)urea |
| SMILES | CCNC(=O)NCCCC(C)(C)C(C)(C)C |
| InChI | InChI=1S/C13H28N2O/c1-7-14-11(16)15-10-8-9-13(5,6)12(2,3)4/h7-10H2,1-6H3,(H2,14,15,16) |
| InChIKey | HTHNJXNBVYMYEB-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.38 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|