C6H17O9P3 — CID 59583557
[ethoxymethoxy(hydroxy)phosphoryl] [ethyl(methyl)phosphoryl] hydrogen phosphate (PubChem CID 59583557) has the molecular formula C6H17O9P3 and a molecular weight of 326.12 g/mol. Its IUPAC name is [ethoxymethoxy(hydroxy)phosphoryl] [ethyl(methyl)phosphoryl] hydrogen phosphate.
| Compound Name | [ethoxymethoxy(hydroxy)phosphoryl] [ethyl(methyl)phosphoryl] hydrogen phosphate |
|---|---|
| PubChem CID | 59583557 |
| Molecular Formula | C6H17O9P3 |
| Molecular Weight | 326.12 g/mol |
| Exact Mass | 326.01 |
| IUPAC Name | [ethoxymethoxy(hydroxy)phosphoryl] [ethyl(methyl)phosphoryl] hydrogen phosphate |
| SMILES | CCOCOP(=O)(O)OP(=O)(O)OP(C)(=O)CC |
| InChI | InChI=1S/C6H17O9P3/c1-4-12-6-13-17(8,9)15-18(10,11)14-16(3,7)5-2/h4-6H2,1-3H3,(H,8,9)(H,10,11) |
| InChIKey | QJAPTLBMVKAZRQ-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 128.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.12 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|