C27H36Li2 — CID 59600006
dilithium;9,9-diheptyl-2,7-dihydrofluorene-2,7-diide (PubChem CID 59600006) has the molecular formula C27H36Li2 and a molecular weight of 374.47 g/mol. Its IUPAC name is dilithium;9,9-diheptyl-2,7-dihydrofluorene-2,7-diide.
| Compound Name | dilithium;9,9-diheptyl-2,7-dihydrofluorene-2,7-diide |
|---|---|
| PubChem CID | 59600006 |
| Molecular Formula | C27H36Li2 |
| Molecular Weight | 374.47 g/mol |
| Exact Mass | 374.31 |
| IUPAC Name | dilithium;9,9-diheptyl-2,7-dihydrofluorene-2,7-diide |
| SMILES | CCCCCCCC1(CCCCCCC)c2c[c-]ccc2-c2cc[c-]cc21.[Li+].[Li+] |
| InChI | InChI=1S/C27H36.2Li/c1-3-5-7-9-15-21-27(22-16-10-8-6-4-2)25-19-13-11-17-23(25)24-18-12-14-20-26(24)27;;/h11-12,17-20H,3-10,15-16,21-22H2,1-2H3;;/q-2;2*+1 |
| InChIKey | DOHYQYGZDFELRJ-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.47 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|