C65H78N11O19S3 — CID 59602950
CID 59602950 (PubChem CID 59602950) has the molecular formula C65H78N11O19S3 and a molecular weight of 1413.60 g/mol.
| Compound Name | CID 59602950 |
|---|---|
| PubChem CID | 59602950 |
| Molecular Formula | C65H78N11O19S3 |
| Molecular Weight | 1413.60 g/mol |
| Exact Mass | 1412.46 |
| IUPAC Name | — |
| SMILES | CC(=O)[C@H](CCCCNC(=O)COCCOCCNc1nc(Cc2ccc(Nc3cc(S(=O)(=O)O)c(N)c4c3C(=O)c3ccccc3C4=O)cc2S(=O)(=O)O)nc(Nc2cccc(S(=O)(=O)O)c2)n1)CC(=O)C(C)(C)CC(=O)C(C)(C)CC(=O)C(C)(C)CC(=O)[C@@H]([NH])Cc1cnc[nH]1 |
| InChI | InChI=1S/C65H78N11O19S3/c1-37(77)38(25-51(79)64(4,5)32-53(81)65(6,7)33-52(80)63(2,3)31-48(78)46(66)28-42-34-68-36-71-42)13-10-11-20-69-55(82)35-95-24-23-94-22-21-70-61-74-54(75-62(76-61)73-40-14-12-15-43(27-40)96(85,86)87)26-39-18-19-41(29-49(39)97(88,89)90)72-47-30-50(98(91,92)93)58(67)57-56(47)59(83)44-16-8-9-17-45(44)60(57)84/h8-9,12,14-19,27,29-30,34,36,38,46,66,72H,10-11,13,20-26,28,31-33,35,67H2,1-7H3,(H,68,71)(H,69,82)(H,85,86,87)(H,88,89,90)(H,91,92,93)(H2,70,73,74,75,76)/t38-,46+/m1/s1 |
| InChIKey | WKXHZLYVGRJBBT-IMISZUIDSA-N |
| XLogP | 6.52 |
| TPSA | 483.42 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 24 |
| Rotatable Bonds | 38 |
| Heavy Atoms | 98 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1413.60 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 24 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|