C26H25ClF3N5O2S — CID 59612377
N-[8-[2-chloro-5-(trifluoromethyl)phenyl]-[1,2,4]triazolo[1,5-a]pyridin-2-yl]-3-(2-methylsulfonylethyl)-1,2,4,5-tetrahydro-3-benzazepin-7-amine (PubChem CID 59612377) has the molecular formula C26H25ClF3N5O2S and a molecular weight of 564.03 g/mol. Its IUPAC name is N-[8-[2-chloro-5-(trifluoromethyl)phenyl]-[1,2,4]triazolo[1,5-a]pyridin-2-yl]-3-(2-methylsulfonylethyl)-1,2,4,5-tetrahydro-3-benzazepin-7-amine.
| Compound Name | N-[8-[2-chloro-5-(trifluoromethyl)phenyl]-[1,2,4]triazolo[1,5-a]pyridin-2-yl]-3-(2-methylsulfonylethyl)-1,2,4,5-tetrahydro-3-benzazepin-7-amine |
|---|---|
| PubChem CID | 59612377 |
| Molecular Formula | C26H25ClF3N5O2S |
| Molecular Weight | 564.03 g/mol |
| Exact Mass | 563.14 |
| IUPAC Name | N-[8-[2-chloro-5-(trifluoromethyl)phenyl]-[1,2,4]triazolo[1,5-a]pyridin-2-yl]-3-(2-methylsulfonylethyl)-1,2,4,5-tetrahydro-3-benzazepin-7-amine |
| SMILES | CS(=O)(=O)CCN1CCc2ccc(Nc3nc4c(-c5cc(C(F)(F)F)ccc5Cl)cccn4n3)cc2CC1 |
| InChI | InChI=1S/C26H25ClF3N5O2S/c1-38(36,37)14-13-34-11-8-17-4-6-20(15-18(17)9-12-34)31-25-32-24-21(3-2-10-35(24)33-25)22-16-19(26(28,29)30)5-7-23(22)27/h2-7,10,15-16H,8-9,11-14H2,1H3,(H,31,33) |
| InChIKey | XKAQVMPWGGIKDK-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 79.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.03 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |