C27H28F3N5O2S — CID 91252673
N-[8-[2-methoxy-5-(trifluoromethyl)phenyl]-[1,2,4]triazolo[1,5-a]pyridin-2-yl]-3-(2-methylsulfinylethyl)-1,2,4,5-tetrahydro-3-benzazepin-7-amine (PubChem CID 91252673) has the molecular formula C27H28F3N5O2S and a molecular weight of 543.62 g/mol. Its IUPAC name is N-[8-[2-methoxy-5-(trifluoromethyl)phenyl]-[1,2,4]triazolo[1,5-a]pyridin-2-yl]-3-(2-methylsulfinylethyl)-1,2,4,5-tetrahydro-3-benzazepin-7-amine.
| Compound Name | N-[8-[2-methoxy-5-(trifluoromethyl)phenyl]-[1,2,4]triazolo[1,5-a]pyridin-2-yl]-3-(2-methylsulfinylethyl)-1,2,4,5-tetrahydro-3-benzazepin-7-amine |
|---|---|
| PubChem CID | 91252673 |
| Molecular Formula | C27H28F3N5O2S |
| Molecular Weight | 543.62 g/mol |
| Exact Mass | 543.19 |
| IUPAC Name | N-[8-[2-methoxy-5-(trifluoromethyl)phenyl]-[1,2,4]triazolo[1,5-a]pyridin-2-yl]-3-(2-methylsulfinylethyl)-1,2,4,5-tetrahydro-3-benzazepin-7-amine |
| SMILES | COc1ccc(C(F)(F)F)cc1-c1cccn2nc(Nc3ccc4c(c3)CCN(CCS(C)=O)CC4)nc12 |
| InChI | InChI=1S/C27H28F3N5O2S/c1-37-24-8-6-20(27(28,29)30)17-23(24)22-4-3-11-35-25(22)32-26(33-35)31-21-7-5-18-9-12-34(14-15-38(2)36)13-10-19(18)16-21/h3-8,11,16-17H,9-10,12-15H2,1-2H3,(H,31,33) |
| InChIKey | IZNRYSKWVWYZBN-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 71.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.62 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |