C22H20ClN5O — CID 67481494
N-[8-(4-chloro-2-methoxyphenyl)-[1,2,4]triazolo[1,5-a]pyridin-2-yl]-1,2,3,4-tetrahydroisoquinolin-6-amine (PubChem CID 67481494) has the molecular formula C22H20ClN5O and a molecular weight of 405.89 g/mol. Its IUPAC name is N-[8-(4-chloro-2-methoxyphenyl)-[1,2,4]triazolo[1,5-a]pyridin-2-yl]-1,2,3,4-tetrahydroisoquinolin-6-amine.
| Compound Name | N-[8-(4-chloro-2-methoxyphenyl)-[1,2,4]triazolo[1,5-a]pyridin-2-yl]-1,2,3,4-tetrahydroisoquinolin-6-amine |
|---|---|
| PubChem CID | 67481494 |
| Molecular Formula | C22H20ClN5O |
| Molecular Weight | 405.89 g/mol |
| Exact Mass | 405.14 |
| IUPAC Name | N-[8-(4-chloro-2-methoxyphenyl)-[1,2,4]triazolo[1,5-a]pyridin-2-yl]-1,2,3,4-tetrahydroisoquinolin-6-amine |
| SMILES | COc1cc(Cl)ccc1-c1cccn2nc(Nc3ccc4c(c3)CCNC4)nc12 |
| InChI | InChI=1S/C22H20ClN5O/c1-29-20-12-16(23)5-7-18(20)19-3-2-10-28-21(19)26-22(27-28)25-17-6-4-15-13-24-9-8-14(15)11-17/h2-7,10-12,24H,8-9,13H2,1H3,(H,25,27) |
| InChIKey | NVMFMVHTUNOIPX-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 63.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.89 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |