C28H30F3N5O2S — CID 91169750
N-[8-[2-ethoxy-5-(trifluoromethyl)phenyl]-[1,2,4]triazolo[1,5-a]pyridin-2-yl]-3-(2-methylsulfinylethyl)-1,2,4,5-tetrahydro-3-benzazepin-7-amine (PubChem CID 91169750) has the molecular formula C28H30F3N5O2S and a molecular weight of 557.64 g/mol. Its IUPAC name is N-[8-[2-ethoxy-5-(trifluoromethyl)phenyl]-[1,2,4]triazolo[1,5-a]pyridin-2-yl]-3-(2-methylsulfinylethyl)-1,2,4,5-tetrahydro-3-benzazepin-7-amine.
| Compound Name | N-[8-[2-ethoxy-5-(trifluoromethyl)phenyl]-[1,2,4]triazolo[1,5-a]pyridin-2-yl]-3-(2-methylsulfinylethyl)-1,2,4,5-tetrahydro-3-benzazepin-7-amine |
|---|---|
| PubChem CID | 91169750 |
| Molecular Formula | C28H30F3N5O2S |
| Molecular Weight | 557.64 g/mol |
| Exact Mass | 557.21 |
| IUPAC Name | N-[8-[2-ethoxy-5-(trifluoromethyl)phenyl]-[1,2,4]triazolo[1,5-a]pyridin-2-yl]-3-(2-methylsulfinylethyl)-1,2,4,5-tetrahydro-3-benzazepin-7-amine |
| SMILES | CCOc1ccc(C(F)(F)F)cc1-c1cccn2nc(Nc3ccc4c(c3)CCN(CCS(C)=O)CC4)nc12 |
| InChI | InChI=1S/C28H30F3N5O2S/c1-3-38-25-9-7-21(28(29,30)31)18-24(25)23-5-4-12-36-26(23)33-27(34-36)32-22-8-6-19-10-13-35(15-16-39(2)37)14-11-20(19)17-22/h4-9,12,17-18H,3,10-11,13-16H2,1-2H3,(H,32,34) |
| InChIKey | SSGJMPWHHXSKLI-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 71.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.64 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |