C24H22ClF2N5O — CID 59612565
N-[8-[5-chloro-2-(2,2-difluoroethoxy)phenyl]-[1,2,4]triazolo[1,5-a]pyridin-2-yl]-2,3,4,5-tetrahydro-1H-3-benzazepin-7-amine (PubChem CID 59612565) has the molecular formula C24H22ClF2N5O and a molecular weight of 469.92 g/mol. Its IUPAC name is N-[8-[5-chloro-2-(2,2-difluoroethoxy)phenyl]-[1,2,4]triazolo[1,5-a]pyridin-2-yl]-2,3,4,5-tetrahydro-1H-3-benzazepin-7-amine.
| Compound Name | N-[8-[5-chloro-2-(2,2-difluoroethoxy)phenyl]-[1,2,4]triazolo[1,5-a]pyridin-2-yl]-2,3,4,5-tetrahydro-1H-3-benzazepin-7-amine |
|---|---|
| PubChem CID | 59612565 |
| Molecular Formula | C24H22ClF2N5O |
| Molecular Weight | 469.92 g/mol |
| Exact Mass | 469.15 |
| IUPAC Name | N-[8-[5-chloro-2-(2,2-difluoroethoxy)phenyl]-[1,2,4]triazolo[1,5-a]pyridin-2-yl]-2,3,4,5-tetrahydro-1H-3-benzazepin-7-amine |
| SMILES | FC(F)COc1ccc(Cl)cc1-c1cccn2nc(Nc3ccc4c(c3)CCNCC4)nc12 |
| InChI | InChI=1S/C24H22ClF2N5O/c25-17-4-6-21(33-14-22(26)27)20(13-17)19-2-1-11-32-23(19)30-24(31-32)29-18-5-3-15-7-9-28-10-8-16(15)12-18/h1-6,11-13,22,28H,7-10,14H2,(H,29,31) |
| InChIKey | KCEGSSBRMIEVJT-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 63.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.92 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |