C13H20O5S — CID 59637931
[2-[(3-methyl-1,4-oxathiocan-3-yl)oxy]-2-oxoethyl] 2-methylprop-2-enoate (PubChem CID 59637931) has the molecular formula C13H20O5S and a molecular weight of 288.36 g/mol. Its IUPAC name is [2-[(3-methyl-1,4-oxathiocan-3-yl)oxy]-2-oxoethyl] 2-methylprop-2-enoate.
| Compound Name | [2-[(3-methyl-1,4-oxathiocan-3-yl)oxy]-2-oxoethyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 59637931 |
| Molecular Formula | C13H20O5S |
| Molecular Weight | 288.36 g/mol |
| Exact Mass | 288.10 |
| IUPAC Name | [2-[(3-methyl-1,4-oxathiocan-3-yl)oxy]-2-oxoethyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC(=O)OC1(C)COCCCCS1 |
| InChI | InChI=1S/C13H20O5S/c1-10(2)12(15)17-8-11(14)18-13(3)9-16-6-4-5-7-19-13/h1,4-9H2,2-3H3 |
| InChIKey | DKEJRXMMTAUQSZ-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.36 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|